C14H10BrClN4OS — CID 16557673
N-[2-[(4-bromothiophen-2-yl)methyl]pyrazol-3-yl]-6-chloropyridine-3-carboxamide (PubChem CID 16557673) has the molecular formula C14H10BrClN4OS and a molecular weight of 397.69 g/mol. Its IUPAC name is N-[2-[(4-bromothiophen-2-yl)methyl]pyrazol-3-yl]-6-chloropyridine-3-carboxamide.
| Compound Name | N-[2-[(4-bromothiophen-2-yl)methyl]pyrazol-3-yl]-6-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 16557673 |
| Molecular Formula | C14H10BrClN4OS |
| Molecular Weight | 397.69 g/mol |
| Exact Mass | 395.94 |
| IUPAC Name | N-[2-[(4-bromothiophen-2-yl)methyl]pyrazol-3-yl]-6-chloropyridine-3-carboxamide |
| SMILES | O=C(Nc1ccnn1Cc1cc(Br)cs1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H10BrClN4OS/c15-10-5-11(22-8-10)7-20-13(3-4-18-20)19-14(21)9-1-2-12(16)17-6-9/h1-6,8H,7H2,(H,19,21) |
| InChIKey | UIECSKDKJIDOKS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.69 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|