C16H11Cl2N3OS2 — CID 16592845
(E)-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide (PubChem CID 16592845) has the molecular formula C16H11Cl2N3OS2 and a molecular weight of 396.32 g/mol. Its IUPAC name is (E)-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 16592845 |
| Molecular Formula | C16H11Cl2N3OS2 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 394.97 |
| IUPAC Name | (E)-N-[4-(2,4-dichlorophenyl)-1,3-thiazol-2-yl]-3-(2-methyl-1,3-thiazol-4-yl)prop-2-enamide |
| SMILES | Cc1nc(/C=C/C(=O)Nc2nc(-c3ccc(Cl)cc3Cl)cs2)cs1 |
| InChI | InChI=1S/C16H11Cl2N3OS2/c1-9-19-11(7-23-9)3-5-15(22)21-16-20-14(8-24-16)12-4-2-10(17)6-13(12)18/h2-8H,1H3,(H,20,21,22)/b5-3+ |
| InChIKey | KOFXFGBNZTZRHW-HWKANZROSA-N |
| XLogP | 5.53 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|