C18H10Cl2F2N2OS — CID 6260356
(E)-3-(2,4-dichlorophenyl)-N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 6260356) has the molecular formula C18H10Cl2F2N2OS and a molecular weight of 411.26 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 6260356 |
| Molecular Formula | C18H10Cl2F2N2OS |
| Molecular Weight | 411.26 g/mol |
| Exact Mass | 409.99 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)Nc1nc(-c2ccc(F)cc2F)cs1 |
| InChI | InChI=1S/C18H10Cl2F2N2OS/c19-11-3-1-10(14(20)7-11)2-6-17(25)24-18-23-16(9-26-18)13-5-4-12(21)8-15(13)22/h1-9H,(H,23,24,25)/b6-2+ |
| InChIKey | YXAWVVNZWBXRMI-QHHAFSJGSA-N |
| XLogP | 6.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.26 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|