C22H19Cl2N3O4S2 — CID 4500497
3-(2,4-dichlorophenyl)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]prop-2-enamide (PubChem CID 4500497) has the molecular formula C22H19Cl2N3O4S2 and a molecular weight of 524.45 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(2,4-dichlorophenyl)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 4500497 |
| Molecular Formula | C22H19Cl2N3O4S2 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 523.02 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-N-[4-(4-morpholin-4-ylsulfonylphenyl)-1,3-thiazol-2-yl]prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1Cl)Nc1nc(-c2ccc(S(=O)(=O)N3CCOCC3)cc2)cs1 |
| InChI | InChI=1S/C22H19Cl2N3O4S2/c23-17-5-1-15(19(24)13-17)4-8-21(28)26-22-25-20(14-32-22)16-2-6-18(7-3-16)33(29,30)27-9-11-31-12-10-27/h1-8,13-14H,9-12H2,(H,25,26,28) |
| InChIKey | DATVDPZQOUGHJZ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|