C22H20ClN3O4S2 — CID 16547893
(E)-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide (PubChem CID 16547893) has the molecular formula C22H20ClN3O4S2 and a molecular weight of 490.01 g/mol. Its IUPAC name is (E)-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 16547893 |
| Molecular Formula | C22H20ClN3O4S2 |
| Molecular Weight | 490.01 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | (E)-N-[4-(2-chlorophenyl)-1,3-thiazol-2-yl]-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(S(=O)(=O)N2CCOCC2)cc1)Nc1nc(-c2ccccc2Cl)cs1 |
| InChI | InChI=1S/C22H20ClN3O4S2/c23-19-4-2-1-3-18(19)20-15-31-22(24-20)25-21(27)10-7-16-5-8-17(9-6-16)32(28,29)26-11-13-30-14-12-26/h1-10,15H,11-14H2,(H,24,25,27)/b10-7+ |
| InChIKey | WSJZKXOVDOTVLA-JXMROGBWSA-N |
| XLogP | 4.14 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.01 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|