C17H19N3O4S2 — CID 8919585
(E)-N-(5-methyl-1,3-thiazol-2-yl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide (PubChem CID 8919585) has the molecular formula C17H19N3O4S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is (E)-N-(5-methyl-1,3-thiazol-2-yl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-methyl-1,3-thiazol-2-yl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 8919585 |
| Molecular Formula | C17H19N3O4S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | (E)-N-(5-methyl-1,3-thiazol-2-yl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
| SMILES | Cc1cnc(NC(=O)/C=C/c2ccc(S(=O)(=O)N3CCOCC3)cc2)s1 |
| InChI | InChI=1S/C17H19N3O4S2/c1-13-12-18-17(25-13)19-16(21)7-4-14-2-5-15(6-3-14)26(22,23)20-8-10-24-11-9-20/h2-7,12H,8-11H2,1H3,(H,18,19,21)/b7-4+ |
| InChIKey | OKJQOLUSYFIKEU-QPJJXVBHSA-N |
| XLogP | 2.12 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|