C21H23ClN2O4S — CID 3929869
N-(2-chloro-4,6-dimethylphenyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide (PubChem CID 3929869) has the molecular formula C21H23ClN2O4S and a molecular weight of 434.95 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3929869 |
| Molecular Formula | C21H23ClN2O4S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-3-(4-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
| SMILES | Cc1cc(C)c(NC(=O)C=Cc2ccc(S(=O)(=O)N3CCOCC3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H23ClN2O4S/c1-15-13-16(2)21(19(22)14-15)23-20(25)8-5-17-3-6-18(7-4-17)29(26,27)24-9-11-28-12-10-24/h3-8,13-14H,9-12H2,1-2H3,(H,23,25) |
| InChIKey | AUWIABAPTRUVNI-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|