C24H29N3O5S — CID 4620273
3-(4-methylphenyl)-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)prop-2-enamide (PubChem CID 4620273) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is 3-(4-methylphenyl)-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | 3-(4-methylphenyl)-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 4620273 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | 3-(4-methylphenyl)-N-(2-morpholin-4-yl-5-morpholin-4-ylsulfonylphenyl)prop-2-enamide |
| SMILES | Cc1ccc(C=CC(=O)Nc2cc(S(=O)(=O)N3CCOCC3)ccc2N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H29N3O5S/c1-19-2-4-20(5-3-19)6-9-24(28)25-22-18-21(33(29,30)27-12-16-32-17-13-27)7-8-23(22)26-10-14-31-15-11-26/h2-9,18H,10-17H2,1H3,(H,25,28) |
| InChIKey | VPAWZXIQFBADDY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|