C23H28N4O4S — CID 55736429
(E)-N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)-3-pyridin-2-ylprop-2-enamide (PubChem CID 55736429) has the molecular formula C23H28N4O4S and a molecular weight of 456.57 g/mol. Its IUPAC name is (E)-N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)-3-pyridin-2-ylprop-2-enamide.
| Compound Name | (E)-N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)-3-pyridin-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 55736429 |
| Molecular Formula | C23H28N4O4S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | (E)-N-(5-morpholin-4-ylsulfonyl-2-piperidin-1-ylphenyl)-3-pyridin-2-ylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccn1)Nc1cc(S(=O)(=O)N2CCOCC2)ccc1N1CCCCC1 |
| InChI | InChI=1S/C23H28N4O4S/c28-23(10-7-19-6-2-3-11-24-19)25-21-18-20(32(29,30)27-14-16-31-17-15-27)8-9-22(21)26-12-4-1-5-13-26/h2-3,6-11,18H,1,4-5,12-17H2,(H,25,28)/b10-7+ |
| InChIKey | AVGIDGKLTPPGJN-JXMROGBWSA-N |
| XLogP | 2.74 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|