C21H29N3O4S — CID 18287293
(2E,4E)-N-(2-morpholin-4-yl-5-piperidin-1-ylsulfonylphenyl)hexa-2,4-dienamide (PubChem CID 18287293) has the molecular formula C21H29N3O4S and a molecular weight of 419.55 g/mol. Its IUPAC name is (2E,4E)-N-(2-morpholin-4-yl-5-piperidin-1-ylsulfonylphenyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(2-morpholin-4-yl-5-piperidin-1-ylsulfonylphenyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 18287293 |
| Molecular Formula | C21H29N3O4S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | (2E,4E)-N-(2-morpholin-4-yl-5-piperidin-1-ylsulfonylphenyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1cc(S(=O)(=O)N2CCCCC2)ccc1N1CCOCC1 |
| InChI | InChI=1S/C21H29N3O4S/c1-2-3-5-8-21(25)22-19-17-18(29(26,27)24-11-6-4-7-12-24)9-10-20(19)23-13-15-28-16-14-23/h2-3,5,8-10,17H,4,6-7,11-16H2,1H3,(H,22,25)/b3-2+,8-5+ |
| InChIKey | WEAOXGHSHKHGAE-YNRRLODASA-N |
| XLogP | 2.77 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|