C20H29N3O4S — CID 18168362
(2E,4E)-N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]hexa-2,4-dienamide (PubChem CID 18168362) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is (2E,4E)-N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 18168362 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | (2E,4E)-N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1cc(S(=O)(=O)N(CC)CC)ccc1N1CCOCC1 |
| InChI | InChI=1S/C20H29N3O4S/c1-4-7-8-9-20(24)21-18-16-17(28(25,26)23(5-2)6-3)10-11-19(18)22-12-14-27-15-13-22/h4,7-11,16H,5-6,12-15H2,1-3H3,(H,21,24)/b7-4+,9-8+ |
| InChIKey | SMLJYKRIKJQCRT-NUXDXBQRSA-N |
| XLogP | 2.62 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|