C23H31N5O6S — CID 4850521
N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-2-(dimethylamino)-5-nitrobenzamide (PubChem CID 4850521) has the molecular formula C23H31N5O6S and a molecular weight of 505.60 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-2-(dimethylamino)-5-nitrobenzamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-2-(dimethylamino)-5-nitrobenzamide |
|---|---|
| PubChem CID | 4850521 |
| Molecular Formula | C23H31N5O6S |
| Molecular Weight | 505.60 g/mol |
| Exact Mass | 505.20 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-2-(dimethylamino)-5-nitrobenzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCOCC2)c(NC(=O)c2cc([N+](=O)[O-])ccc2N(C)C)c1 |
| InChI | InChI=1S/C23H31N5O6S/c1-5-27(6-2)35(32,33)18-8-10-22(26-11-13-34-14-12-26)20(16-18)24-23(29)19-15-17(28(30)31)7-9-21(19)25(3)4/h7-10,15-16H,5-6,11-14H2,1-4H3,(H,24,29) |
| InChIKey | UVBWTZFTTHATQY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|