C22H31N3O4S2 — CID 16546078
N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-4-ethyl-5-methylthiophene-2-carboxamide (PubChem CID 16546078) has the molecular formula C22H31N3O4S2 and a molecular weight of 465.64 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-4-ethyl-5-methylthiophene-2-carboxamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-4-ethyl-5-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 16546078 |
| Molecular Formula | C22H31N3O4S2 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-4-ethyl-5-methylthiophene-2-carboxamide |
| SMILES | CCc1cc(C(=O)Nc2cc(S(=O)(=O)N(CC)CC)ccc2N2CCOCC2)sc1C |
| InChI | InChI=1S/C22H31N3O4S2/c1-5-17-14-21(30-16(17)4)22(26)23-19-15-18(31(27,28)25(6-2)7-3)8-9-20(19)24-10-12-29-13-11-24/h8-9,14-15H,5-7,10-13H2,1-4H3,(H,23,26) |
| InChIKey | YCJVQGARBGGDSG-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |