C21H27N3O4S2 — CID 4810870
N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-3-thiophen-2-ylprop-2-enamide (PubChem CID 4810870) has the molecular formula C21H27N3O4S2 and a molecular weight of 449.60 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 4810870 |
| Molecular Formula | C21H27N3O4S2 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-3-thiophen-2-ylprop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCOCC2)c(NC(=O)C=Cc2cccs2)c1 |
| InChI | InChI=1S/C21H27N3O4S2/c1-3-24(4-2)30(26,27)18-8-9-20(23-11-13-28-14-12-23)19(16-18)22-21(25)10-7-17-6-5-15-29-17/h5-10,15-16H,3-4,11-14H2,1-2H3,(H,22,25) |
| InChIKey | MSJYZRULUVBAEZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|