C23H27ClFN3O4S — CID 16562763
(E)-3-(2-chloro-6-fluorophenyl)-N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]prop-2-enamide (PubChem CID 16562763) has the molecular formula C23H27ClFN3O4S and a molecular weight of 496.00 g/mol. Its IUPAC name is (E)-3-(2-chloro-6-fluorophenyl)-N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chloro-6-fluorophenyl)-N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 16562763 |
| Molecular Formula | C23H27ClFN3O4S |
| Molecular Weight | 496.00 g/mol |
| Exact Mass | 495.14 |
| IUPAC Name | (E)-3-(2-chloro-6-fluorophenyl)-N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]prop-2-enamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCOCC2)c(NC(=O)/C=C/c2c(F)cccc2Cl)c1 |
| InChI | InChI=1S/C23H27ClFN3O4S/c1-3-28(4-2)33(30,31)17-8-10-22(27-12-14-32-15-13-27)21(16-17)26-23(29)11-9-18-19(24)6-5-7-20(18)25/h5-11,16H,3-4,12-15H2,1-2H3,(H,26,29)/b11-9+ |
| InChIKey | CKEONJVORIWULS-PKNBQFBNSA-N |
| XLogP | 4.00 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.00 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|