C20H33N3O4S — CID 3602856
N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-3,3-dimethylbutanamide (PubChem CID 3602856) has the molecular formula C20H33N3O4S and a molecular weight of 411.57 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-3,3-dimethylbutanamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 3602856 |
| Molecular Formula | C20H33N3O4S |
| Molecular Weight | 411.57 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]-3,3-dimethylbutanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCOCC2)c(NC(=O)CC(C)(C)C)c1 |
| InChI | InChI=1S/C20H33N3O4S/c1-6-23(7-2)28(25,26)16-8-9-18(22-10-12-27-13-11-22)17(14-16)21-19(24)15-20(3,4)5/h8-9,14H,6-7,10-13,15H2,1-5H3,(H,21,24) |
| InChIKey | MCANCRZKKJGZCT-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |