C20H26N4O5S2 — CID 3564701
N-[[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 3564701) has the molecular formula C20H26N4O5S2 and a molecular weight of 466.59 g/mol. Its IUPAC name is N-[[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3564701 |
| Molecular Formula | C20H26N4O5S2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | N-[[5-(diethylsulfamoyl)-2-morpholin-4-ylphenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCOCC2)c(NC(=S)NC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C20H26N4O5S2/c1-3-24(4-2)31(26,27)15-7-8-17(23-9-12-28-13-10-23)16(14-15)21-20(30)22-19(25)18-6-5-11-29-18/h5-8,11,14H,3-4,9-10,12-13H2,1-2H3,(H2,21,22,25,30) |
| InChIKey | YIXCPFFSKYBCHP-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 104.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|