C16H20N2O3S — CID 9415021
(2E,4E)-N-(3-pyrrolidin-1-ylsulfonylphenyl)hexa-2,4-dienamide (PubChem CID 9415021) has the molecular formula C16H20N2O3S and a molecular weight of 320.41 g/mol. Its IUPAC name is (2E,4E)-N-(3-pyrrolidin-1-ylsulfonylphenyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(3-pyrrolidin-1-ylsulfonylphenyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 9415021 |
| Molecular Formula | C16H20N2O3S |
| Molecular Weight | 320.41 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | (2E,4E)-N-(3-pyrrolidin-1-ylsulfonylphenyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C16H20N2O3S/c1-2-3-4-10-16(19)17-14-8-7-9-15(13-14)22(20,21)18-11-5-6-12-18/h2-4,7-10,13H,5-6,11-12H2,1H3,(H,17,19)/b3-2+,10-4+ |
| InChIKey | JGFAPIZJNSWKFA-KHVHPYDTSA-N |
| XLogP | 2.54 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|