C12H14N2O3S — CID 60635779
N-(3-sulfamoylphenyl)hexa-2,4-dienamide (PubChem CID 60635779) has the molecular formula C12H14N2O3S and a molecular weight of 266.32 g/mol. Its IUPAC name is N-(3-sulfamoylphenyl)hexa-2,4-dienamide.
| Compound Name | N-(3-sulfamoylphenyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 60635779 |
| Molecular Formula | C12H14N2O3S |
| Molecular Weight | 266.32 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | N-(3-sulfamoylphenyl)hexa-2,4-dienamide |
| SMILES | CC=CC=CC(=O)Nc1cccc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C12H14N2O3S/c1-2-3-4-8-12(15)14-10-6-5-7-11(9-10)18(13,16)17/h2-9H,1H3,(H,14,15)(H2,13,16,17) |
| InChIKey | VLNMHIWSDRAGHI-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|