C13H15NO2 — CID 60638423
(2E,4E)-N-[3-(hydroxymethyl)phenyl]hexa-2,4-dienamide (PubChem CID 60638423) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (2E,4E)-N-[3-(hydroxymethyl)phenyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[3-(hydroxymethyl)phenyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 60638423 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (2E,4E)-N-[3-(hydroxymethyl)phenyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)Nc1cccc(CO)c1 |
| InChI | InChI=1S/C13H15NO2/c1-2-3-4-8-13(16)14-12-7-5-6-11(9-12)10-15/h2-9,15H,10H2,1H3,(H,14,16)/b3-2+,8-4+ |
| InChIKey | YMLXHELDXRIJIA-CRBCFSCISA-N |
| XLogP | 2.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|