C16H21N3O2 — CID 75407731
(2E,4E)-N-[[3-(dimethylcarbamoylamino)phenyl]methyl]hexa-2,4-dienamide (PubChem CID 75407731) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is (2E,4E)-N-[[3-(dimethylcarbamoylamino)phenyl]methyl]hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-[[3-(dimethylcarbamoylamino)phenyl]methyl]hexa-2,4-dienamide |
|---|---|
| PubChem CID | 75407731 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | (2E,4E)-N-[[3-(dimethylcarbamoylamino)phenyl]methyl]hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NCc1cccc(NC(=O)N(C)C)c1 |
| InChI | InChI=1S/C16H21N3O2/c1-4-5-6-10-15(20)17-12-13-8-7-9-14(11-13)18-16(21)19(2)3/h4-11H,12H2,1-3H3,(H,17,20)(H,18,21)/b5-4+,10-6+ |
| InChIKey | GYSFPOPNLMNVIB-UMCKCUICSA-N |
| XLogP | 2.53 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|