C17H25N3O — CID 129065693
3-[3-[(2E,4Z)-2-(dimethylamino)hexa-2,4-dienyl]phenyl]-1,1-dimethylurea (PubChem CID 129065693) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 3-[3-[(2E,4Z)-2-(dimethylamino)hexa-2,4-dienyl]phenyl]-1,1-dimethylurea.
| Compound Name | 3-[3-[(2E,4Z)-2-(dimethylamino)hexa-2,4-dienyl]phenyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 129065693 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 3-[3-[(2E,4Z)-2-(dimethylamino)hexa-2,4-dienyl]phenyl]-1,1-dimethylurea |
| SMILES | C/C=C\C=C(/Cc1cccc(NC(=O)N(C)C)c1)N(C)C |
| InChI | InChI=1S/C17H25N3O/c1-6-7-11-16(19(2)3)13-14-9-8-10-15(12-14)18-17(21)20(4)5/h6-12H,13H2,1-5H3,(H,18,21)/b7-6-,16-11+ |
| InChIKey | ZARIMVWIYZIWNW-HWEBNEHYSA-N |
| XLogP | 3.34 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|