C11H13F3N2O — CID 70150186
1,1-dimethyl-3-[3-(2,2,2-trifluoroethyl)phenyl]urea (PubChem CID 70150186) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is 1,1-dimethyl-3-[3-(2,2,2-trifluoroethyl)phenyl]urea.
| Compound Name | 1,1-dimethyl-3-[3-(2,2,2-trifluoroethyl)phenyl]urea |
|---|---|
| PubChem CID | 70150186 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1,1-dimethyl-3-[3-(2,2,2-trifluoroethyl)phenyl]urea |
| SMILES | CN(C)C(=O)Nc1cccc(CC(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2O/c1-16(2)10(17)15-9-5-3-4-8(6-9)7-11(12,13)14/h3-6H,7H2,1-2H3,(H,15,17) |
| InChIKey | JELMVKUZYZIKRR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |