C15H16F3N3O2 — CID 99631966
N'-[(2R)-1-cyanopropan-2-yl]-N'-methyl-N-[3-(2,2,2-trifluoroethyl)phenyl]oxamide (PubChem CID 99631966) has the molecular formula C15H16F3N3O2 and a molecular weight of 327.31 g/mol. Its IUPAC name is N'-[(2R)-1-cyanopropan-2-yl]-N'-methyl-N-[3-(2,2,2-trifluoroethyl)phenyl]oxamide.
| Compound Name | N'-[(2R)-1-cyanopropan-2-yl]-N'-methyl-N-[3-(2,2,2-trifluoroethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 99631966 |
| Molecular Formula | C15H16F3N3O2 |
| Molecular Weight | 327.31 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N'-[(2R)-1-cyanopropan-2-yl]-N'-methyl-N-[3-(2,2,2-trifluoroethyl)phenyl]oxamide |
| SMILES | C[C@H](CC#N)N(C)C(=O)C(=O)Nc1cccc(CC(F)(F)F)c1 |
| InChI | InChI=1S/C15H16F3N3O2/c1-10(6-7-19)21(2)14(23)13(22)20-12-5-3-4-11(8-12)9-15(16,17)18/h3-5,8,10H,6,9H2,1-2H3,(H,20,22)/t10-/m1/s1 |
| InChIKey | AKJDEWVPGGQFPM-SNVBAGLBSA-N |
| XLogP | 2.49 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|