C13H13BrFN3O2 — CID 119044037
N-(2-bromo-5-fluorophenyl)-N'-(1-cyanopropan-2-yl)-N'-methyloxamide (PubChem CID 119044037) has the molecular formula C13H13BrFN3O2 and a molecular weight of 342.17 g/mol. Its IUPAC name is N-(2-bromo-5-fluorophenyl)-N'-(1-cyanopropan-2-yl)-N'-methyloxamide.
| Compound Name | N-(2-bromo-5-fluorophenyl)-N'-(1-cyanopropan-2-yl)-N'-methyloxamide |
|---|---|
| PubChem CID | 119044037 |
| Molecular Formula | C13H13BrFN3O2 |
| Molecular Weight | 342.17 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | N-(2-bromo-5-fluorophenyl)-N'-(1-cyanopropan-2-yl)-N'-methyloxamide |
| SMILES | CC(CC#N)N(C)C(=O)C(=O)Nc1cc(F)ccc1Br |
| InChI | InChI=1S/C13H13BrFN3O2/c1-8(5-6-16)18(2)13(20)12(19)17-11-7-9(15)3-4-10(11)14/h3-4,7-8H,5H2,1-2H3,(H,17,19) |
| InChIKey | WKVJRKKOHQCYKL-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.17 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|