C15H16N4O2 — CID 99632176
N'-[(2S)-1-cyanopropan-2-yl]-N-(1H-indol-4-yl)-N'-methyloxamide (PubChem CID 99632176) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is N'-[(2S)-1-cyanopropan-2-yl]-N-(1H-indol-4-yl)-N'-methyloxamide.
| Compound Name | N'-[(2S)-1-cyanopropan-2-yl]-N-(1H-indol-4-yl)-N'-methyloxamide |
|---|---|
| PubChem CID | 99632176 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | N'-[(2S)-1-cyanopropan-2-yl]-N-(1H-indol-4-yl)-N'-methyloxamide |
| SMILES | C[C@@H](CC#N)N(C)C(=O)C(=O)Nc1cccc2[nH]ccc12 |
| InChI | InChI=1S/C15H16N4O2/c1-10(6-8-16)19(2)15(21)14(20)18-13-5-3-4-12-11(13)7-9-17-12/h3-5,7,9-10,17H,6H2,1-2H3,(H,18,20)/t10-/m0/s1 |
| InChIKey | JKZHGFDXHIKXSG-JTQLQIEISA-N |
| XLogP | 1.87 |
| TPSA | 88.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|