C13H13F3N4O2 — CID 119044033
N'-(1-cyanopropan-2-yl)-N'-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]oxamide (PubChem CID 119044033) has the molecular formula C13H13F3N4O2 and a molecular weight of 314.27 g/mol. Its IUPAC name is N'-(1-cyanopropan-2-yl)-N'-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]oxamide.
| Compound Name | N'-(1-cyanopropan-2-yl)-N'-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]oxamide |
|---|---|
| PubChem CID | 119044033 |
| Molecular Formula | C13H13F3N4O2 |
| Molecular Weight | 314.27 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | N'-(1-cyanopropan-2-yl)-N'-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]oxamide |
| SMILES | CC(CC#N)N(C)C(=O)C(=O)Nc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C13H13F3N4O2/c1-8(5-6-17)20(2)12(22)11(21)19-9-3-4-10(18-7-9)13(14,15)16/h3-4,7-8H,5H2,1-2H3,(H,19,21) |
| InChIKey | FZSHEZMCPWWVEP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 86.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|