C10H11F3N2O — CID 82706557
2-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide (PubChem CID 82706557) has the molecular formula C10H11F3N2O and a molecular weight of 232.20 g/mol. Its IUPAC name is 2-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide.
| Compound Name | 2-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 82706557 |
| Molecular Formula | C10H11F3N2O |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 2-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide |
| SMILES | CC(C)C(=O)Nc1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C10H11F3N2O/c1-6(2)9(16)15-7-3-4-8(14-5-7)10(11,12)13/h3-6H,1-2H3,(H,15,16) |
| InChIKey | JWQHEXMWKOISMD-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |