C13H17F3N4O — CID 82795400
2-piperazin-1-yl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide (PubChem CID 82795400) has the molecular formula C13H17F3N4O and a molecular weight of 302.30 g/mol. Its IUPAC name is 2-piperazin-1-yl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide.
| Compound Name | 2-piperazin-1-yl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 82795400 |
| Molecular Formula | C13H17F3N4O |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-piperazin-1-yl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(C(F)(F)F)nc1)N1CCNCC1 |
| InChI | InChI=1S/C13H17F3N4O/c1-9(20-6-4-17-5-7-20)12(21)19-10-2-3-11(18-8-10)13(14,15)16/h2-3,8-9,17H,4-7H2,1H3,(H,19,21) |
| InChIKey | XNDFURVVLMOALI-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |