C11H12F3N3O — CID 115778116
N-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidine-1-carboxamide (PubChem CID 115778116) has the molecular formula C11H12F3N3O and a molecular weight of 259.23 g/mol. Its IUPAC name is N-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 115778116 |
| Molecular Formula | C11H12F3N3O |
| Molecular Weight | 259.23 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | N-[6-(trifluoromethyl)-3-pyridinyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)nc1)N1CCCC1 |
| InChI | InChI=1S/C11H12F3N3O/c12-11(13,14)9-4-3-8(7-15-9)16-10(18)17-5-1-2-6-17/h3-4,7H,1-2,5-6H2,(H,16,18) |
| InChIKey | GMIYFBLVQJIYBR-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.23 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |