C12H12F4N2O — CID 47456948
N-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide (PubChem CID 47456948) has the molecular formula C12H12F4N2O and a molecular weight of 276.23 g/mol. Its IUPAC name is N-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide.
| Compound Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 47456948 |
| Molecular Formula | C12H12F4N2O |
| Molecular Weight | 276.23 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | N-[4-fluoro-3-(trifluoromethyl)phenyl]pyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(C(F)(F)F)c1)N1CCCC1 |
| InChI | InChI=1S/C12H12F4N2O/c13-10-4-3-8(7-9(10)12(14,15)16)17-11(19)18-5-1-2-6-18/h3-4,7H,1-2,5-6H2,(H,17,19) |
| InChIKey | OLCUFTZXHHFNNY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.23 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |