C14H18F3N3O — CID 79156712
N-[4-(aminomethyl)-3-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 79156712) has the molecular formula C14H18F3N3O and a molecular weight of 301.31 g/mol. Its IUPAC name is N-[4-(aminomethyl)-3-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | N-[4-(aminomethyl)-3-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 79156712 |
| Molecular Formula | C14H18F3N3O |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[4-(aminomethyl)-3-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | NCc1ccc(NC(=O)N2CCCCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H18F3N3O/c15-14(16,17)12-8-11(5-4-10(12)9-18)19-13(21)20-6-2-1-3-7-20/h4-5,8H,1-3,6-7,9,18H2,(H,19,21) |
| InChIKey | ZKYUINISVPKBDL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |