benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid

C14H11F4NO2 — CID 174945939

IUPACbenzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid
SMILESO=C(O)Nc1ccc(F)c(C(F)(F)F)c1.c1ccccc1
InChIInChI=1S/C8H5F4NO2.C6H6/c9-6-2-1-4(13-7(14)15)3-5(6)8(10,11)12;1-2-4-6-5-3-1/h1-3,13H,(H,14,15);1-6H
InChIKeyHOXFHZTWVPWHME-UHFFFAOYSA-N
MW301.24 g/mol
LogP4.62
Rot. Bonds1

About benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid

benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 174945939) has the molecular formula C14H11F4NO2 and a molecular weight of 301.24 g/mol. Its IUPAC name is benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid.

Molecular Properties

Compound Namebenzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid
PubChem CID174945939
Molecular FormulaC14H11F4NO2
Molecular Weight301.24 g/mol
Exact Mass301.07
IUPAC Namebenzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid
SMILESO=C(O)Nc1ccc(F)c(C(F)(F)F)c1.c1ccccc1
InChIInChI=1S/C8H5F4NO2.C6H6/c9-6-2-1-4(13-7(14)15)3-5(6)8(10,11)12;1-2-4-6-5-3-1/h1-3,13H,(H,14,15);1-6H
InChIKeyHOXFHZTWVPWHME-UHFFFAOYSA-N
XLogP4.62
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms21
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500301.24
LogP ≤ 54.62
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 101

Analyze benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid?
The IUPAC name of benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid (CID 174945939) is benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid.
What is the SMILES notation for benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid?
The canonical SMILES for benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid is O=C(O)Nc1ccc(F)c(C(F)(F)F)c1.c1ccccc1.
What is the InChIKey of benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid?
The InChIKey is HOXFHZTWVPWHME-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5F4NO2.C6H6/c9-6-2-1-4(13-7(14)15)3-5(6)8(10,11)12;1-2-4-6-5-3-1/h1-3,13H,(H,14,15);1-6H.
What are the key properties of benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid?
benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid has a molecular weight of 301.24 g/mol, XLogP of 4.62, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid is sourced from PubChem (CID 174945939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).