C14H11F4NO2 — CID 174945939
benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid (PubChem CID 174945939) has the molecular formula C14H11F4NO2 and a molecular weight of 301.24 g/mol. Its IUPAC name is benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 174945939 |
| Molecular Formula | C14H11F4NO2 |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | benzene;[4-fluoro-3-(trifluoromethyl)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(F)c(C(F)(F)F)c1.c1ccccc1 |
| InChI | InChI=1S/C8H5F4NO2.C6H6/c9-6-2-1-4(13-7(14)15)3-5(6)8(10,11)12;1-2-4-6-5-3-1/h1-3,13H,(H,14,15);1-6H |
| InChIKey | HOXFHZTWVPWHME-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |