C9H5F6NO2 — CID 91432072
[3,4-bis(trifluoromethyl)phenyl]carbamic acid (PubChem CID 91432072) has the molecular formula C9H5F6NO2 and a molecular weight of 273.13 g/mol. Its IUPAC name is [3,4-bis(trifluoromethyl)phenyl]carbamic acid.
| Compound Name | [3,4-bis(trifluoromethyl)phenyl]carbamic acid |
|---|---|
| PubChem CID | 91432072 |
| Molecular Formula | C9H5F6NO2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 273.02 |
| IUPAC Name | [3,4-bis(trifluoromethyl)phenyl]carbamic acid |
| SMILES | O=C(O)Nc1ccc(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C9H5F6NO2/c10-8(11,12)5-2-1-4(16-7(17)18)3-6(5)9(13,14)15/h1-3,16H,(H,17,18) |
| InChIKey | XNKUWJAGGMDNJL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |