C18H13ClF6N2O2 — CID 20562818
N'-[3,4-bis(trifluoromethyl)phenyl]-N-[(4-chlorophenyl)methyl]propanediamide (PubChem CID 20562818) has the molecular formula C18H13ClF6N2O2 and a molecular weight of 438.76 g/mol. Its IUPAC name is N'-[3,4-bis(trifluoromethyl)phenyl]-N-[(4-chlorophenyl)methyl]propanediamide.
| Compound Name | N'-[3,4-bis(trifluoromethyl)phenyl]-N-[(4-chlorophenyl)methyl]propanediamide |
|---|---|
| PubChem CID | 20562818 |
| Molecular Formula | C18H13ClF6N2O2 |
| Molecular Weight | 438.76 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | N'-[3,4-bis(trifluoromethyl)phenyl]-N-[(4-chlorophenyl)methyl]propanediamide |
| SMILES | O=C(CC(=O)Nc1ccc(C(F)(F)F)c(C(F)(F)F)c1)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H13ClF6N2O2/c19-11-3-1-10(2-4-11)9-26-15(28)8-16(29)27-12-5-6-13(17(20,21)22)14(7-12)18(23,24)25/h1-7H,8-9H2,(H,26,28)(H,27,29) |
| InChIKey | FRDAVPRLJNIZLG-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.76 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|