C17H14F6N2O2S — CID 20562782
N'-[3,4-bis(trifluoromethyl)phenyl]-N-[(3-methylthiophen-2-yl)methyl]propanediamide (PubChem CID 20562782) has the molecular formula C17H14F6N2O2S and a molecular weight of 424.37 g/mol. Its IUPAC name is N'-[3,4-bis(trifluoromethyl)phenyl]-N-[(3-methylthiophen-2-yl)methyl]propanediamide.
| Compound Name | N'-[3,4-bis(trifluoromethyl)phenyl]-N-[(3-methylthiophen-2-yl)methyl]propanediamide |
|---|---|
| PubChem CID | 20562782 |
| Molecular Formula | C17H14F6N2O2S |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | N'-[3,4-bis(trifluoromethyl)phenyl]-N-[(3-methylthiophen-2-yl)methyl]propanediamide |
| SMILES | Cc1ccsc1CNC(=O)CC(=O)Nc1ccc(C(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F6N2O2S/c1-9-4-5-28-13(9)8-24-14(26)7-15(27)25-10-2-3-11(16(18,19)20)12(6-10)17(21,22)23/h2-6H,7-8H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | GCEAPQHXZJQFKD-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|