C16H13ClF3NO — CID 18290212
2-(2-chlorophenyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 18290212) has the molecular formula C16H13ClF3NO and a molecular weight of 327.73 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(2-chlorophenyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 18290212 |
| Molecular Formula | C16H13ClF3NO |
| Molecular Weight | 327.73 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[4-methyl-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | Cc1ccc(NC(=O)Cc2ccccc2Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C16H13ClF3NO/c1-10-6-7-12(9-13(10)16(18,19)20)21-15(22)8-11-4-2-3-5-14(11)17/h2-7,9H,8H2,1H3,(H,21,22) |
| InChIKey | JYQKBMRWJFPDEY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.73 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |