C14H12F3NOS — CID 24632484
N-[4-methyl-3-(trifluoromethyl)phenyl]-2-thiophen-2-ylacetamide (PubChem CID 24632484) has the molecular formula C14H12F3NOS and a molecular weight of 299.32 g/mol. Its IUPAC name is N-[4-methyl-3-(trifluoromethyl)phenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[4-methyl-3-(trifluoromethyl)phenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 24632484 |
| Molecular Formula | C14H12F3NOS |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | N-[4-methyl-3-(trifluoromethyl)phenyl]-2-thiophen-2-ylacetamide |
| SMILES | Cc1ccc(NC(=O)Cc2cccs2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H12F3NOS/c1-9-4-5-10(7-12(9)14(15,16)17)18-13(19)8-11-3-2-6-20-11/h2-7H,8H2,1H3,(H,18,19) |
| InChIKey | FDFLSYBCZFFESR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |