C19H24N2O3S2 — CID 4303625
N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-2-thiophen-2-ylacetamide (PubChem CID 4303625) has the molecular formula C19H24N2O3S2 and a molecular weight of 392.55 g/mol. Its IUPAC name is N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 4303625 |
| Molecular Formula | C19H24N2O3S2 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.12 |
| IUPAC Name | N-[3-(azepan-1-ylsulfonyl)-4-methylphenyl]-2-thiophen-2-ylacetamide |
| SMILES | Cc1ccc(NC(=O)Cc2cccs2)cc1S(=O)(=O)N1CCCCCC1 |
| InChI | InChI=1S/C19H24N2O3S2/c1-15-8-9-16(20-19(22)14-17-7-6-12-25-17)13-18(15)26(23,24)21-10-4-2-3-5-11-21/h6-9,12-13H,2-5,10-11,14H2,1H3,(H,20,22) |
| InChIKey | ULCIESITPKUHKV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |