C17H12ClF3N4O6 — CID 20562784
N-[(3-chloro-4-nitrophenyl)methyl]-N'-[4-nitro-3-(trifluoromethyl)phenyl]propanediamide (PubChem CID 20562784) has the molecular formula C17H12ClF3N4O6 and a molecular weight of 460.75 g/mol. Its IUPAC name is N-[(3-chloro-4-nitrophenyl)methyl]-N'-[4-nitro-3-(trifluoromethyl)phenyl]propanediamide.
| Compound Name | N-[(3-chloro-4-nitrophenyl)methyl]-N'-[4-nitro-3-(trifluoromethyl)phenyl]propanediamide |
|---|---|
| PubChem CID | 20562784 |
| Molecular Formula | C17H12ClF3N4O6 |
| Molecular Weight | 460.75 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | N-[(3-chloro-4-nitrophenyl)methyl]-N'-[4-nitro-3-(trifluoromethyl)phenyl]propanediamide |
| SMILES | O=C(CC(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1)NCc1ccc([N+](=O)[O-])c(Cl)c1 |
| InChI | InChI=1S/C17H12ClF3N4O6/c18-12-5-9(1-3-14(12)25(30)31)8-22-15(26)7-16(27)23-10-2-4-13(24(28)29)11(6-10)17(19,20)21/h1-6H,7-8H2,(H,22,26)(H,23,27) |
| InChIKey | ZFBUKFHZMPKQSU-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.75 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|