C17H13F3N2O5 — CID 75450931
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[4-nitro-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 75450931) has the molecular formula C17H13F3N2O5 and a molecular weight of 382.29 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[4-nitro-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[4-nitro-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 75450931 |
| Molecular Formula | C17H13F3N2O5 |
| Molecular Weight | 382.29 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[4-nitro-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(Cc1ccc2c(c1)OCCO2)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H13F3N2O5/c18-17(19,20)12-9-11(2-3-13(12)22(24)25)21-16(23)8-10-1-4-14-15(7-10)27-6-5-26-14/h1-4,7,9H,5-6,8H2,(H,21,23) |
| InChIKey | KGPHSOOJUWYSSD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|