C11H14F3N3O4 — CID 143036887
3-amino-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide;methanol (PubChem CID 143036887) has the molecular formula C11H14F3N3O4 and a molecular weight of 309.24 g/mol. Its IUPAC name is 3-amino-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide;methanol.
| Compound Name | 3-amino-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide;methanol |
|---|---|
| PubChem CID | 143036887 |
| Molecular Formula | C11H14F3N3O4 |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 3-amino-N-[4-nitro-3-(trifluoromethyl)phenyl]propanamide;methanol |
| SMILES | CO.NCCC(=O)Nc1ccc([N+](=O)[O-])c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10F3N3O3.CH4O/c11-10(12,13)7-5-6(15-9(17)3-4-14)1-2-8(7)16(18)19;1-2/h1-2,5H,3-4,14H2,(H,15,17);2H,1H3 |
| InChIKey | PPWVKHPHSILQHY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 118.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|