C21H23F3N2O5 — CID 4733307
2-(3-hexoxyphenoxy)-N-[4-nitro-3-(trifluoromethyl)phenyl]acetamide (PubChem CID 4733307) has the molecular formula C21H23F3N2O5 and a molecular weight of 440.42 g/mol. Its IUPAC name is 2-(3-hexoxyphenoxy)-N-[4-nitro-3-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-(3-hexoxyphenoxy)-N-[4-nitro-3-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4733307 |
| Molecular Formula | C21H23F3N2O5 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-(3-hexoxyphenoxy)-N-[4-nitro-3-(trifluoromethyl)phenyl]acetamide |
| SMILES | CCCCCCOc1cccc(OCC(=O)Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C21H23F3N2O5/c1-2-3-4-5-11-30-16-7-6-8-17(13-16)31-14-20(27)25-15-9-10-19(26(28)29)18(12-15)21(22,23)24/h6-10,12-13H,2-5,11,14H2,1H3,(H,25,27) |
| InChIKey | LMLHDVARTJPFIW-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|