C25H24F3N3O4 — CID 90149868
N-naphthalen-2-yl-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyacetamide (PubChem CID 90149868) has the molecular formula C25H24F3N3O4 and a molecular weight of 487.48 g/mol. Its IUPAC name is N-naphthalen-2-yl-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyacetamide.
| Compound Name | N-naphthalen-2-yl-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyacetamide |
|---|---|
| PubChem CID | 90149868 |
| Molecular Formula | C25H24F3N3O4 |
| Molecular Weight | 487.48 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | N-naphthalen-2-yl-2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyacetamide |
| SMILES | O=C(COC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C25H24F3N3O4/c26-25(27,28)22-14-20(9-12-23(22)31(33)34)29-18-7-10-21(11-8-18)35-15-24(32)30-19-6-5-16-3-1-2-4-17(16)13-19/h1-6,9,12-14,18,21,29H,7-8,10-11,15H2,(H,30,32) |
| InChIKey | SWWYMQCTINTTRO-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.48 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|