C27H26ClF3N4O5 — CID 160836258
3-(6-chloroquinolin-2-yl)-N-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethyl]-2-oxopropanamide (PubChem CID 160836258) has the molecular formula C27H26ClF3N4O5 and a molecular weight of 578.98 g/mol. Its IUPAC name is 3-(6-chloroquinolin-2-yl)-N-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethyl]-2-oxopropanamide.
| Compound Name | 3-(6-chloroquinolin-2-yl)-N-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethyl]-2-oxopropanamide |
|---|---|
| PubChem CID | 160836258 |
| Molecular Formula | C27H26ClF3N4O5 |
| Molecular Weight | 578.98 g/mol |
| Exact Mass | 578.15 |
| IUPAC Name | 3-(6-chloroquinolin-2-yl)-N-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethyl]-2-oxopropanamide |
| SMILES | O=C(Cc1ccc2cc(Cl)ccc2n1)C(=O)NCCOC1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C27H26ClF3N4O5/c28-17-2-9-23-16(13-17)1-3-20(34-23)15-25(36)26(37)32-11-12-40-21-7-4-18(5-8-21)33-19-6-10-24(35(38)39)22(14-19)27(29,30)31/h1-3,6,9-10,13-14,18,21,33H,4-5,7-8,11-12,15H2,(H,32,37) |
| InChIKey | SHLHBCQLKMNWLZ-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.98 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|