C29H34ClF3N4O6 — CID 144632765
(5-chloro-2,3-dihydro-1-benzofuran-2-yl)-[4-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethoxymethyl]piperazin-1-yl]methanone (PubChem CID 144632765) has the molecular formula C29H34ClF3N4O6 and a molecular weight of 627.06 g/mol. Its IUPAC name is (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-[4-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethoxymethyl]piperazin-1-yl]methanone.
| Compound Name | (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-[4-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethoxymethyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 144632765 |
| Molecular Formula | C29H34ClF3N4O6 |
| Molecular Weight | 627.06 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | (5-chloro-2,3-dihydro-1-benzofuran-2-yl)-[4-[2-[4-[4-nitro-3-(trifluoromethyl)anilino]cyclohexyl]oxyethoxymethyl]piperazin-1-yl]methanone |
| SMILES | O=C(C1Cc2cc(Cl)ccc2O1)N1CCN(COCCOC2CCC(Nc3ccc([N+](=O)[O-])c(C(F)(F)F)c3)CC2)CC1 |
| InChI | InChI=1S/C29H34ClF3N4O6/c30-20-1-8-26-19(15-20)16-27(43-26)28(38)36-11-9-35(10-12-36)18-41-13-14-42-23-5-2-21(3-6-23)34-22-4-7-25(37(39)40)24(17-22)29(31,32)33/h1,4,7-8,15,17,21,23,27,34H,2-3,5-6,9-14,16,18H2 |
| InChIKey | YCBYOMWTZPOHCA-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.06 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|