C27H31F4N5O6 — CID 118654234
2-[4-[3-(fluoromethyl)-4-nitroanilino]cyclohexyl]oxy-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]ethanone (PubChem CID 118654234) has the molecular formula C27H31F4N5O6 and a molecular weight of 597.57 g/mol. Its IUPAC name is 2-[4-[3-(fluoromethyl)-4-nitroanilino]cyclohexyl]oxy-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]ethanone.
| Compound Name | 2-[4-[3-(fluoromethyl)-4-nitroanilino]cyclohexyl]oxy-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 118654234 |
| Molecular Formula | C27H31F4N5O6 |
| Molecular Weight | 597.57 g/mol |
| Exact Mass | 597.22 |
| IUPAC Name | 2-[4-[3-(fluoromethyl)-4-nitroanilino]cyclohexyl]oxy-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]ethanone |
| SMILES | O=C(COC1CCC(Nc2ccc([N+](=O)[O-])c(CF)c2)CC1)N1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C27H31F4N5O6/c28-15-17-13-20(3-7-24(17)35(38)39)32-18-1-5-22(6-2-18)42-16-26(37)34-11-9-19(10-12-34)33-21-4-8-25(36(40)41)23(14-21)27(29,30)31/h3-4,7-8,13-14,18-19,22,32-33H,1-2,5-6,9-12,15-16H2 |
| InChIKey | RFAKKCNMIWSBAQ-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 139.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.57 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|