C27H39F3N4O5 — CID 158285819
2-[1-(cyclohexanecarbonyl)piperidin-4-yl]oxy-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]ethanone;methane (PubChem CID 158285819) has the molecular formula C27H39F3N4O5 and a molecular weight of 556.63 g/mol. Its IUPAC name is 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]oxy-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]ethanone;methane.
| Compound Name | 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]oxy-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]ethanone;methane |
|---|---|
| PubChem CID | 158285819 |
| Molecular Formula | C27H39F3N4O5 |
| Molecular Weight | 556.63 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | 2-[1-(cyclohexanecarbonyl)piperidin-4-yl]oxy-1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]ethanone;methane |
| SMILES | C.O=C(COC1CCN(C(=O)C2CCCCC2)CC1)N1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C26H35F3N4O5.CH4/c27-26(28,29)22-16-20(6-7-23(22)33(36)37)30-19-8-12-31(13-9-19)24(34)17-38-21-10-14-32(15-11-21)25(35)18-4-2-1-3-5-18;/h6-7,16,18-19,21,30H,1-5,8-15,17H2;1H4 |
| InChIKey | GKTQAOFPDXZDQM-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 105.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.63 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|