C20H28F3N5O3 — CID 70845307
1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-piperazin-1-ylbutan-1-one (PubChem CID 70845307) has the molecular formula C20H28F3N5O3 and a molecular weight of 443.47 g/mol. Its IUPAC name is 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-piperazin-1-ylbutan-1-one.
| Compound Name | 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-piperazin-1-ylbutan-1-one |
|---|---|
| PubChem CID | 70845307 |
| Molecular Formula | C20H28F3N5O3 |
| Molecular Weight | 443.47 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-4-piperazin-1-ylbutan-1-one |
| SMILES | O=C(CCCN1CCNCC1)N1CCC(Nc2ccc([N+](=O)[O-])c(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C20H28F3N5O3/c21-20(22,23)17-14-16(3-4-18(17)28(30)31)25-15-5-10-27(11-6-15)19(29)2-1-9-26-12-7-24-8-13-26/h3-4,14-15,24-25H,1-2,5-13H2 |
| InChIKey | NSNMEGUXOMLGDV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.47 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|