C29H37F3N4O3 — CID 58576800
1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-(4-propylphenyl)piperidin-1-yl]propan-1-one (PubChem CID 58576800) has the molecular formula C29H37F3N4O3 and a molecular weight of 546.63 g/mol. Its IUPAC name is 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-(4-propylphenyl)piperidin-1-yl]propan-1-one.
| Compound Name | 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-(4-propylphenyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 58576800 |
| Molecular Formula | C29H37F3N4O3 |
| Molecular Weight | 546.63 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | 1-[4-[4-nitro-3-(trifluoromethyl)anilino]piperidin-1-yl]-3-[4-(4-propylphenyl)piperidin-1-yl]propan-1-one |
| SMILES | CCCc1ccc(C2CCN(CCC(=O)N3CCC(Nc4ccc([N+](=O)[O-])c(C(F)(F)F)c4)CC3)CC2)cc1 |
| InChI | InChI=1S/C29H37F3N4O3/c1-2-3-21-4-6-22(7-5-21)23-10-15-34(16-11-23)17-14-28(37)35-18-12-24(13-19-35)33-25-8-9-27(36(38)39)26(20-25)29(30,31)32/h4-9,20,23-24,33H,2-3,10-19H2,1H3 |
| InChIKey | FPEJVPSHGJWJPN-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 78.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.63 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|